1,6-Bis(trichlorosilyl)hexane
- Product Name1,6-Bis(trichlorosilyl)hexane
- CAS13083-94-8
- MFC6H12Cl6Si2
- MW353.05
- EINECS235-994-7
- MOL File13083-94-8.mol
Chemical Properties
| Melting point | <25°C |
| Boiling point | 281 °C |
| Density | 1.33 |
| refractive index | 1.48 |
| Flash point | 75 °C |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.327 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1768655 |
| InChI | 1S/C6H12Cl6Si2/c7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-6H2 |
| InChIKey | ICJGKYTXBRDUMV-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CCCCCC[Si](Cl)(Cl)Cl |
| EPA Substance Registry System | Silane, 1,6-hexanediylbis[trichloro- (13083-94-8) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2931900090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
