1,6-Bis(trichlorosilyl)hexane
- Product Name1,6-Bis(trichlorosilyl)hexane
- CAS13083-94-8
- CBNumberCB4772556
- MFC6H12Cl6Si2
- MW353.05
- EINECS235-994-7
- MDL NumberMFCD00053189
- MOL File13083-94-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | <25°C |
| Boiling point | 281 °C(lit.) |
| Density | 1.327 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 167 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.327 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1768655 |
| InChI | 1S/C6H12Cl6Si2/c7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-6H2 |
| InChIKey | ICJGKYTXBRDUMV-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CCCCCC[Si](Cl)(Cl)Cl |
| EPA Substance Registry System | Silane, 1,6-hexanediylbis[trichloro- (13083-94-8) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 14-34 | |||||||||
| Safety Statements | 26-36/37/39-43-45 | |||||||||
| RIDADR | UN 2987 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29319000 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|