4-Methoxy-2,2,6,6-tetramethylpiperidine 1-oxyl
- Product Name4-Methoxy-2,2,6,6-tetramethylpiperidine 1-oxyl
- CAS95407-69-5
- MFC10H20NO2
- MW186.27
- EINECS619-125-2
- MOL File95407-69-5.mol
Chemical Properties
| Melting point | 40.5-44 °C (lit.) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| BRN | 4740399 |
| InChI | 1S/C10H20NO2/c1-9(2)6-8(13-5)7-10(3,4)11(9)12/h8H,6-7H2,1-5H3 |
| InChIKey | SFXHWRCRQNGVLJ-UHFFFAOYSA-N |
| SMILES | COC1CC(C)(C)N([O])C(C)(C)C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |