4-tert-Butylphthalonitrile
- Product Name4-tert-Butylphthalonitrile
- CAS32703-80-3
- MFC12H12N2
- MW184.24
- EINECS251-166-8
- MOL File32703-80-3.mol
Chemical Properties
| Melting point | 49-51 °C(lit.) |
| Boiling point | 165-168 °C6 mm Hg(lit.) |
| Density | 1.04±0.1 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.6266 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C12H12N2/c1-12(2,3)11-5-4-9(7-13)10(6-11)8-14/h4-6H,1-3H3 |
| InChIKey | LOTMIRVNJTVTSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C#N)c(c1)C#N |
