THEICTA
- Product NameTHEICTA
- CAS40220-08-4
- MFC18H21N3O9
- MW423.37
- EINECS254-843-6
- MOL File40220-08-4.mol
Chemical Properties
| Melting point | 52-53 °C(lit.) |
| Boiling point | 568.3±45.0 °C(Predicted) |
| Density | 1.298±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.4489 (25) |
| Flash point | 195 |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | -2.66±0.20(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| Water Solubility | 1.497g/L at 20.1℃ |
| Cosmetics Ingredients Functions | BINDING |
| InChI | InChI=1S/C18H21N3O9/c1-4-13(22)28-10-7-19-16(25)20(8-11-29-14(23)5-2)18(27)21(17(19)26)9-12-30-15(24)6-3/h4-6H,1-3,7-12H2 |
| InChIKey | YIJYFLXQHDOQGW-UHFFFAOYSA-N |
| SMILES | N1(CCOC(=O)C=C)C(=O)N(CCOC(=O)C=C)C(=O)N(CCOC(=O)C=C)C1=O |
| LogP | 2.61 at 25℃ |
| EPA Substance Registry System | 2-Propenoic acid, (2,4,6-trioxo-1,3,5-triazine-1,3,5(2H,4H,6H)-triyl)tri-2,1-ethanediyl ester (40220-08-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |