4-Amino-2-methylbenzoic acid
- Product Name4-Amino-2-methylbenzoic acid
- CAS2486-75-1
- MFC8H9NO2
- MW151.16
- EINECS200-297-9
- MOL File2486-75-1.mol
Chemical Properties
| Melting point | 160-165 °C |
| Boiling point | 339.5±30.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 4.86±0.25(Predicted) |
| form | Solid |
| color | Light orange to Yellow to Green |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | XRSQZFJLEPBPOZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C=C1C |
| CAS DataBase Reference | 2486-75-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |