Dihydrolipoic acid
- Product NameDihydrolipoic acid
- CAS462-20-4
- MFC8H16O2S2
- MW208.34
- EINECS610-288-5
- MOL File462-20-4.mol
Chemical Properties
| Melting point | 62 °C |
| Boiling point | 161.5 °C(Press: 0.7 Torr) |
| Density | 1.132 g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5220-1.5260 |
| storage temp. | +2C to +8C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.74±0.10(Predicted) |
| form | liquid |
| color | light yellow |
| InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) |
| InChIKey | IZFHEQBZOYJLPK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCC(S)CCS |
| LogP | 1.9 at 20℃ |
| Surface tension | 53.6mN/m at 1.02g/L and 21℃ |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | RH0525000 |
| HS Code | 2930.90.4950 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
