DL-Dithiothreitol
- Product NameDL-Dithiothreitol
- CAS27565-41-9
- MFC4H10O2S2
- MW154.25
- EINECS248-531-9
- MOL File27565-41-9.mol
Chemical Properties
| Melting point | 41-44 °C(lit.) |
| Boiling point | 125-130 °C (2 mmHg) |
| Density | 1.04 g/mL at 20 °C |
| refractive index | 1.5200 (estimate) |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Liquid |
| color | White |
| Water Solubility | Soluble |
| Merck | 3376 |
| InChI | InChI=1/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4-/s3 |
| InChIKey | VHJLVAABSRFDPM-APQYWOSTNA-N |
| SMILES | [C@@H](O)(CS)[C@H](O)CS |&1:0,4,r| |
| CAS DataBase Reference | 27565-41-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2,3-Butanediol, 1,4-dimercapto-, (2R,3R)-rel-(27565-41-9) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 25-36/37/38-22 |
| Safety Statements | 26-45-36 |
| WGK Germany | 3 |
| RTECS | EK1610000 |
| F | 3-10-16-23 |
| HS Code | 29309090 |
| Toxicity | mouse,LD50,intramuscular,108mg/kg (108mg/kg),BEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLD,Journal of Pharmacy and Pharmacology. Vol. 1, Pg. 576, 1949. |