3-Cyanobenzyl alcohol
- Product Name3-Cyanobenzyl alcohol
- CAS874-97-5
- MFC8H7NO
- MW133.15
- EINECS
- MOL File874-97-5.mol
Chemical Properties
| Melting point | 28-32 °C |
| Boiling point | 165°C 16mm |
| Density | 1,13 g/cm3 |
| refractive index | 1.5502 (28.5℃) |
| Flash point | 109 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 13.90±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| BRN | 3235555 |
| InChI | InChI=1S/C8H7NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,10H,6H2 |
| InChIKey | PCOFIIVWHXIDGT-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(CO)=C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
