1-Methyl-1H-pyrazol-3-amine
- Product Name1-Methyl-1H-pyrazol-3-amine
- CAS1904-31-0
- MFC4H7N3
- MW97.12
- EINECS
- MOL File1904-31-0.mol
Chemical Properties
| Boiling point | 93 °C |
| Density | 1.12g/ml |
| refractive index | 1.5420-1.5460 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 4.04±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C4H7N3/c1-7-3-2-4(5)6-7/h2-3H,1H3,(H2,5,6) |
| InChIKey | MOGQNVSKBCVIPW-UHFFFAOYSA-N |
| SMILES | N1(C)C=CC(N)=N1 |
| CAS DataBase Reference | 1904-31-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-methyl-3-aminopyrazole(1904-31-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2735 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |