![Oxalic acid bis[2,4,5-trichloro-6-(pentyloxycarbonyl)phenyl] ester Structure](/CAS/GIF/30431-54-0.gif)
Oxalic acid bis[2,4,5-trichloro-6-(pentyloxycarbonyl)phenyl] ester
- Product NameOxalic acid bis[2,4,5-trichloro-6-(pentyloxycarbonyl)phenyl] ester
- CAS30431-54-0
- MFC26H24Cl6O8
- MW677.18
- EINECS250-195-3
- MOL File30431-54-0.mol
Chemical Properties
| Melting point | 83 °C |
| Boiling point | 692.1±55.0 °C(Predicted) |
| Density | 1.434±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C26H24Cl6O8/c1-3-5-7-9-37-23(33)17-19(31)13(27)11-15(29)21(17)39-25(35)26(36)40-22-16(30)12-14(28)20(32)18(22)24(34)38-10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | TZZLVFUOAYMTHA-UHFFFAOYSA-N |
| SMILES | C(OC1=C(Cl)C=C(Cl)C(Cl)=C1C(OCCCCC)=O)(=O)C(OC1=C(Cl)C=C(Cl)C(Cl)=C1C(OCCCCC)=O)=O |
| EPA Substance Registry System | Ethanedioic acid, bis[3,4,6-trichloro-2-[(pentyloxy)carbonyl]phenyl] ester (30431-54-0) |
Safety Information
| Risk Statements | 23/24/25 |
| Safety Statements | 36/37/39 |
| WGK Germany | 3 |
| F | 8-21 |
| TSCA | TSCA listed |
| HS Code | 2934.20.8000 |
![OXALIC ACID BIS[2,4,5-TRICHLORO-6-(PENTYLOXYCARBONYL)PHENYL] ESTER pictures](https://img.chemicalbook.com/ProductImageEN/2019-12/Small/2c850bc2-1444-4ff9-9608-8424e01018ce.jpg)