2-Chlorophenoxyacetic acid
- Product Name2-Chlorophenoxyacetic acid
- CAS614-61-9
- MFC8H7ClO3
- MW186.59
- EINECS210-388-5
- MOL File614-61-9.mol
Chemical Properties
| Melting point | 144-148 °C |
| Boiling point | 266.91°C (rough estimate) |
| Density | 1.3245 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Store at room temperature |
| pka | 3.05(at 25℃) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 1.278g/L(25 ºC) |
| BRN | 1103151 |
| InChI | InChI=1S/C8H7ClO3/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | OPQYFNRLWBWCST-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COC1=CC=CC=C1Cl |
| CAS DataBase Reference | 614-61-9(CAS DataBase Reference) |
| NIST Chemistry Reference | (2-Chlorophenoxy)acetic acid(614-61-9) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| RTECS | AF9900000 |
| HS Code | 2918.99.4700 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 614-61-9(Hazardous Substances Data) |
