2-Bromo-4-iodopyridine
- Product Name2-Bromo-4-iodopyridine
- CAS100523-96-4
- MFC5H3BrIN
- MW283.89
- EINECS680-955-3
- MOL File100523-96-4.mol
Chemical Properties
| Melting point | 61°C |
| Boiling point | 286.7±25.0 °C(Predicted) |
| Density | 2.347±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | -0.59±0.10(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| BRN | 108925 |
| InChI | InChI=1S/C5H3BrIN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | HPKRNLGLZYOVJS-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(I)=C1 |
| CAS DataBase Reference | 100523-96-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
