| Melting point |
105-109 °C |
| Boiling point |
351.35°C (rough estimate) |
| Density |
1.1290 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to crystal |
| color |
White to Light yellow to Light red |
| Water Solubility |
insoluble |
| Merck |
14,6408 |
| BRN |
2052424 |
| InChI |
InChI=1S/C17H12O2/c18-17(14-7-2-1-3-8-14)19-16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| InChIKey |
DWJIJRSTYFPKGD-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C=CC=C2)=CC=C1OC(=O)C1=CC=CC=C1 |
| LogP |
4.223 (est) |
| CAS DataBase Reference |
93-44-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzoic acid, 2-naphthyl ester(93-44-7) |
| EPA Substance Registry System |
2-Naphthalenol, benzoate (93-44-7) |
