![DL-Buthionine-[s,r]-sulfoximine Structure](/CAS/GIF/5072-26-4.gif)
DL-Buthionine-[s,r]-sulfoximine
- Product NameDL-Buthionine-[s,r]-sulfoximine
- CAS5072-26-4
- MFC8H18N2O3S
- MW222.31
- EINECS628-045-7
- MOL File5072-26-4.mol
Chemical Properties
| Melting point | 215 °C (dec.)(lit.) |
| Boiling point | 382.3±52.0 °C(Predicted) |
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Fluffy Powder |
| color | White |
| biological source | synthetic (organic) |
| Water Solubility | water: 50mg/mL, clear to very slightly hazy, colorless to yellow |
| Merck | 13,1520 |
| BRN | 2367136 |
| InChI | 1S/C8H18N2O3S/c1-2-3-5-14(10,13)6-4-7(9)8(11)12/h7,10H,2-6,9H2,1H3,(H,11,12) |
| InChIKey | KJQFBVYMGADDTQ-UHFFFAOYSA-N |
| SMILES | CCCCS(=N)(=O)CCC(N)C(O)=O |
| CAS DataBase Reference | 5072-26-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | EK7713435 |
| F | 10 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
