Methyl 4-fluorobenzoate
- Product NameMethyl 4-fluorobenzoate
- CAS403-33-8
- MFC8H7FO2
- MW154.14
- EINECS206-956-7
- MOL File403-33-8.mol
Chemical Properties
| Melting point | 4.5 °C |
| Boiling point | 197 °C |
| Density | 1.20 |
| refractive index | 1.50 |
| Flash point | 77 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| Specific Gravity | 1.201.192 |
| BRN | 2085925 |
| InChI | InChI=1S/C8H7FO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5H,1H3 |
| InChIKey | MSEBQGULDWDIRW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(F)C=C1 |
| CAS DataBase Reference | 403-33-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-F-C6H4-COOCH3(403-33-8) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-37/38-41-36/38 |
| Safety Statements | 26-36/39-36 |
| RIDADR | NA1993 |
| WGK Germany | 2 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
