1,3-Dibromo-5-chlorobenzene
- Product Name1,3-Dibromo-5-chlorobenzene
- CAS14862-52-3
- MFC6H3Br2Cl
- MW270.35
- EINECS627-184-0
- MOL File14862-52-3.mol
Chemical Properties
| Melting point | 91-94 °C (lit.) |
| Boiling point | 256 °C |
| Density | 2.021±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C6H3Br2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | FNKCOUREFBNNHG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Cl)=CC(Br)=C1 |
| CAS DataBase Reference | 14862-52-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29039990 |
