| Melting point |
<0°C |
| Boiling point |
75°C 0,5mm |
| Density |
0,963 g/cm3 |
| refractive index |
1.5010-1.5030 |
| Flash point |
103°C |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
0.963 |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| InChI |
InChI=1S/C11H17ClSi/c1-13(2,12)10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3 |
| InChIKey |
ASSMBLOISZSMMP-UHFFFAOYSA-N |
| SMILES |
C1(CCC[Si](Cl)(C)C)=CC=CC=C1 |
| CAS DataBase Reference |
17146-09-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, chlorodimethyl(3-phenylpropyl)- (17146-09-7) |
