(3-Glycidoxypropyl)methyldiethoxysilane
- Product Name(3-Glycidoxypropyl)methyldiethoxysilane
- CAS2897-60-1
- MFC11H24O4Si
- MW248.39
- EINECS220-780-8
- MOL File2897-60-1.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 122-126 °C5 mm Hg(lit.) |
| Density | 0.978 g/mL at 25 °C(lit.) |
| vapor pressure | 0-7910Pa at 25℃ |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 0.978 |
| color | Colorless to Almost colorless |
| Water Solubility | 1.2-1000g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 121965 |
| InChI | 1S/C11H24O4Si/c1-4-14-16(3,15-5-2)8-6-7-12-9-11-10-13-11/h11H,4-10H2,1-3H3 |
| InChIKey | OTARVPUIYXHRRB-UHFFFAOYSA-N |
| SMILES | CCO[Si](C)(CCCOCC1CO1)OCC |
| LogP | -0.7-2.7 at 20℃ |
| CAS DataBase Reference | 2897-60-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |