3-Glycidoxypropyldimethoxymethylsilane
- Product Name3-Glycidoxypropyldimethoxymethylsilane
- CAS65799-47-5
- MFC9H20O4Si
- MW220.34
- EINECS265-929-8
- MOL File65799-47-5.mol
Chemical Properties
| Boiling point | 100 °C4 mm Hg(lit.) |
| Density | 1.02 g/mL at 25 °C(lit.) |
| vapor pressure | 3Pa at 25℃ |
| refractive index | n |
| Flash point | 221 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | liquid |
| Specific Gravity | 1.02 |
| color | Colorless to Light yellow |
| Water Solubility | 12g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C9H20O4Si/c1-10-14(3,11-2)6-4-5-12-7-9-8-13-9/h9H,4-8H2,1-3H3 |
| InChIKey | WHGNXNCOTZPEEK-UHFFFAOYSA-N |
| SMILES | C(C1OC1)OCCC[Si](C)(OC)OC |
| LogP | 1.7 at 20℃ |
| CAS DataBase Reference | 65799-47-5(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39-45 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
