| Melting point |
-37°C |
| Boiling point |
115 °C |
| Density |
0.9 |
| vapor pressure |
1hPa at 20℃ |
| refractive index |
1.4220 |
| Flash point |
117°C |
| storage temp. |
Storage temp. 2-8°C |
| form |
clear liquid |
| Specific Gravity |
0.9 |
| color |
Colorless to Almost colorless |
| Water Solubility |
Soluble in organic solvents. Insoluble in water. |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| Sensitive |
Moisture Sensitive |
| BRN |
8625082 |
| InChI |
InChI=1S/C13H30O3Si/c1-5-6-7-8-9-10-11-12-13-17(14-2,15-3)16-4/h5-13H2,1-4H3 |
| InChIKey |
KQAHMVLQCSALSX-UHFFFAOYSA-N |
| SMILES |
[Si](CCCCCCCCCC)(OC)(OC)OC |
| LogP |
3.75 at 25℃ |
