Dihydroethidium
- Product NameDihydroethidium
- CAS104821-25-2
- MFC21H21N3
- MW315.41
- EINECS
- MOL File104821-25-2.mol
Chemical Properties
| Boiling point | 580.4±50.0 °C(Predicted) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | acetonitrile: soluble |
| pka | 5.30±0.40(Predicted) |
| form | powder |
| color | Pink to dark brown |
| Appearance | Solid Powder |
| λmax | 355 nm |
| BRN | 5107482 |
| Biological Applications | Apoptosis assay; generating and detecting reactive oxygen species (ROS); detecting nucleic acids,cells; measuring respiratory burst; superoxide indicator; viability assay |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C21H21N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,21H,2,22-23H2,1H3 |
| InChIKey | XYJODUBPWNZLML-UHFFFAOYSA-N |
| SMILES | C1=C2C(N(CC)C(C3=CC=CC=C3)C3=C2C=CC(N)=C3)=CC(N)=C1 |
Safety Information
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |