5-Bromo-5-nitro-1,3-dioxane
- Product Name5-Bromo-5-nitro-1,3-dioxane
- CAS30007-47-7
- MFC4H6BrNO4
- MW212
- EINECS250-001-7
- MOL File30007-47-7.mol
Chemical Properties
| Melting point | 58-60 °C |
| Boiling point | 280.8±40.0 °C(Predicted) |
| Density | 1.070 |
| vapor pressure | 1.6Pa at 20℃ |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS(pH 7.2) (1:4): 0.2 mg/ml; Ethanol: 25 mg/ml |
| form | Solid |
| color | White to Almost white |
| Water Solubility | Soluble in water at 12.5mg/ml |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| Cosmetic Ingredient Review (CIR) | 5-Bromo-5-nitro-1,3-dioxane (30007-47-7) |
| InChI | InChI=1S/C4H6BrNO4/c5-4(6(7)8)1-9-3-10-2-4/h1-3H2 |
| InChIKey | XVBRCOKDZVQYAY-UHFFFAOYSA-N |
| SMILES | O1CC(Br)([N+]([O-])=O)COC1 |
| LogP | 1.6 at 23℃ |
| CAS DataBase Reference | 30007-47-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-38 |
| Safety Statements | 36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| RTECS | JG9650000 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1A |
