| Melting point |
152.5-153.5 °C(lit.) |
| Boiling point |
409.4±44.0 °C(Predicted) |
| Density |
1.53 g/cm3 |
| Flash point |
196 °F |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| color |
Light yellow to Yellow to Green |
| Water Solubility |
Partly miscible in water. |
| InChI |
InChI=1S/C13H7ClOS/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7H |
| InChIKey |
ZCDADJXRUCOCJE-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)SC2=C1C=C(Cl)C=C2 |
| CAS DataBase Reference |
86-39-5(CAS DataBase Reference) |
| EPA Substance Registry System |
9H-Thioxanthen-9-one, 2-chloro- (86-39-5) |
