3,5-Dinitrobenzyl alcohol
- Product Name3,5-Dinitrobenzyl alcohol
- CAS71022-43-0
- MFC7H6N2O5
- MW198.13
- EINECS275-131-1
- MOL File71022-43-0.mol
Chemical Properties
| Melting point | 88-91 °C (lit.) |
| Boiling point | 335.43°C (rough estimate) |
| Density | 1.560±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5460 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 13.40±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 2054388 |
| InChI | InChI=1S/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 |
| InChIKey | GPHYIQCSMDYRGJ-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 71022-43-0(CAS DataBase Reference) |
Safety Information
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |