1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
- Product Name1-Hexyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
- CAS382150-50-7
- MFC12H19F6N3O4S2
- MW447.42
- EINECS
- MOL File382150-50-7.mol
Chemical Properties
| Melting point | -9°C(lit.) |
| Density | 1.37 g/cm3 |
| refractive index | 1.4300 to 1.4340 |
| Flash point | -9℃ |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| PH | 6 (H2O, 20℃) |
| InChI | InChI=1S/C10H19N2.C2F6NO4S2/c1-3-4-5-6-7-12-9-8-11(2)10-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8-10H,3-7H2,1-2H3;/q+1;-1 |
| InChIKey | RCNFOZUBFOFJKZ-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+]1(C)C=CN(CCCCCC)C=1 |
| ECW | 5.3 V |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2935 90 90 |
| Storage Class | 10 - Combustible liquids |