| Melting point |
85-88 °C |
| Boiling point |
511.5±50.0 °C(Predicted) |
| Density |
1.248±0.06 g/cm3(Predicted) |
| refractive index |
-5.3 ° (C=4, AcOH) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.86±0.10(Predicted) |
| color |
White |
| optical activity |
Consistent with structure |
| Water Solubility |
Soluble in methanol. Slightly soluble in water. |
| BRN |
2817463 |
| InChI |
InChI=1S/C17H17NO4/c19-16(20)15(11-13-7-3-1-4-8-13)18-17(21)22-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,18,21)(H,19,20)/t15-/m1/s1 |
| InChIKey |
RRONHWAVOYADJL-OAHLLOKOSA-N |
| SMILES |
C(O)(=O)[C@@H](CC1=CC=CC=C1)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference |
2448-45-5(CAS DataBase Reference) |
