Methyl 4-nitrobenzoate
- Product NameMethyl 4-nitrobenzoate
- CAS619-50-1
- MFC8H7NO4
- MW181.15
- EINECS210-599-2
- MOL File619-50-1.mol
Chemical Properties
| Melting point | 94-96 °C (lit.) 94-96 °C |
| Boiling point | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| Flash point | 94-96°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol is almost transparent. |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 1912198 |
| InChI | 1S/C8H7NO4/c1-13-8(10)6-2-4-7(5-3-6)9(11)12/h2-5H,1H3 |
| InChIKey | YOJAHJGBFDPSDI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 619-50-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitrobenzoic acid methyl ester(619-50-1) |
| EPA Substance Registry System | Methyl-4-nitrobenzoate (619-50-1) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | DH5775000 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |