5-Bromo-2-methoxybenzenesulfonyl chloride
- Product Name5-Bromo-2-methoxybenzenesulfonyl chloride
- CAS23095-05-8
- MFC7H6BrClO3S
- MW285.54
- EINECS
- MOL File23095-05-8.mol
Chemical Properties
| Melting point | 115-118 °C (lit.) |
| Boiling point | 362.3±32.0 °C(Predicted) |
| Density | 1.717 |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 3093014 |
| InChI | 1S/C7H6BrClO3S/c1-12-6-3-2-5(8)4-7(6)13(9,10)11/h2-4H,1H3 |
| InChIKey | IXSBNNRUQYYMRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1S(Cl)(=O)=O |
| CAS DataBase Reference | 23095-05-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29093090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
