5-Bromo-2,4-dichloropyrimidine
- Product Name5-Bromo-2,4-dichloropyrimidine
- CAS36082-50-5
- MFC4HBrCl2N2
- MW227.87
- EINECS629-358-1
- MOL File36082-50-5.mol
Chemical Properties
| Melting point | 29-30 °C (lit.) |
| Boiling point | 128 °C/15 mmHg (lit.) |
| Density | 1.781 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ether (Slightly), Ethyl Acetate (Slightly), Toluene (Slightly) |
| pka | -4.26±0.29(Predicted) |
| form | Liquid or Low Melting Solid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.781 |
| BRN | 124441 |
| InChI | InChI=1S/C4HBrCl2N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | SIKXIUWKPGWBBF-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C(Cl)=N1 |
| CAS DataBase Reference | 36082-50-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,C |
| Risk Statements | 23/24/25-34-43 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |