| Melting point |
-6°C |
| Density |
1.40 |
| refractive index |
1.4216 |
| storage temp. |
Store below +30°C. |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| PH |
5 (H2O, 20℃) |
| Water Solubility |
Miscible with methanol, acetonitrile, acetone, dichloromethane and dimethyl sulfoxide. Immiscible with water and diethyl ether. |
| Major Application |
battery manufacturing |
| InChI |
InChI=1S/C9H20N.C2F6NO4S2/c1-3-4-7-10(2)8-5-6-9-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-9H2,1-2H3;/q+1;-1 |
| InChIKey |
HSLXOARVFIWOQF-UHFFFAOYSA-N |
| SMILES |
S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+]1(CCCC1)(C)CCCC |
| EPA Substance Registry System |
Pyrrolidinium, 1-butyl-1-methyl-, salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1) (223437-11-4) |
| ECW |
5.5V |
