1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate
- Product Name1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate
- CAS367522-96-1
- MFC10H20F3NO3S
- MW291.3309096
- EINECS
- MOL File367522-96-1.mol
Chemical Properties
| Melting point | 4°C(lit.) |
| Density | 1.25 g/cm3 (20℃) |
| refractive index | 1.4320 to 1.4360 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| PH | 6 (H2O, 25℃) |
| BRN | 9820503 |
| InChI | InChI=1S/C9H20N.CHF3O3S/c1-3-4-7-10(2)8-5-6-9-10;2-1(3,4)8(5,6)7/h3-9H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WZJDNKTZWIOOJE-UHFFFAOYSA-M |
| SMILES | S(=O)(=O)([O-])C(F)(F)F.[N+]1(CCCC1)(C)CCCC |
| ECW | 4.2 V |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933 99 80 |
