TETRAKIS(DIMETHYLAMINO)TITANIUM
- Product NameTETRAKIS(DIMETHYLAMINO)TITANIUM
- CAS3275-24-9
- MFC2H7NTi
- MW92.95
- EINECS221-904-3
- MOL File3275-24-9.mol
Chemical Properties
| Melting point | <4°C |
| Boiling point | 50 °C0.5 mm Hg(lit.) |
| Density | 0.947 g/mL at 25 °C(lit.) |
| refractive index | 1.55 |
| Flash point | -22 °F |
| storage temp. | Flammables area |
| form | liquid |
| Specific Gravity | 0.96 |
| color | yellow to orange |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| InChI | 1S/4C2H6N.Ti/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | MNWRORMXBIWXCI-UHFFFAOYSA-N |
| SMILES | CN(C)[Ti](N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 3275-24-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrakis(dimethylamino)titanium(3275-24-9) |
| EPA Substance Registry System | Methanamine, N-methyl-, titanium(4+) salt (3275-24-9) |
Safety Information
| Hazard Codes | F,C,Xi |
| Risk Statements | 11-14-34 |
| Safety Statements | 16-26-36/37/39-43-45 |
| RIDADR | UN 3398 4.3/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 4.3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B Water-react 1 |
