Tetrakis(dimethylamino)tin
- Product NameTetrakis(dimethylamino)tin
- CAS1066-77-9
- MFC8H24N4Sn
- MW295.01
- EINECS201-131-8
- MOL File1066-77-9.mol
Chemical Properties
| Boiling point | 53-55 °C (0.1 mmHg) |
| Density | 1.17 |
| Flash point | -7 °C |
| form | liquid |
| pka | 3.60±0.70(Predicted) |
| color | colorless to pale-yellow |
| Specific Gravity | 1.169 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive |
| InChI | InChI=1S/4C2H6N.Sn/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | WHXTVQNIFGXMSB-UHFFFAOYSA-N |
| SMILES | [Sn](N(C)C)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 1066-77-9 |
Safety Information
| Hazard Codes | T-F,C,F |
| Risk Statements | 41-36/37/38-23/24/25-11-34-20/21/22 |
| Safety Statements | 36/37/39-26-16-45 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 3, 8 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 2 Skin Corr. 1B |