| Melting point |
-56 °C |
| Boiling point |
199 °C(lit.) |
| Density |
1.338 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.549(lit.) |
| Flash point |
171 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Light orange to Yellow |
| Specific Gravity |
1.35 |
| BRN |
1929735 |
| Henry's Law Constant |
3.0×10-3 mol/(m3Pa) at 25℃, Hine and Mookerjee (1975) |
| InChI |
InChI=1S/C8H9Br/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 |
| InChIKey |
HVRUGFJYCAFAAN-UHFFFAOYSA-N |
| SMILES |
C1(Br)=CC=CC=C1CC |
| CAS DataBase Reference |
1973-22-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzene, 1-bromo-2-ethyl-(1973-22-4) |
