2-Bromoethylbenzene
- Product Name2-Bromoethylbenzene
- CAS1973-22-4
- CBNumberCB3118706
- MFC8H9Br
- MW185.06
- EINECS217-823-8
- MDL NumberMFCD00000077
- MOL File1973-22-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -56 °C |
| Boiling point | 199 °C(lit.) |
| Density | 1.338 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 171 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.35 |
| BRN | 1929735 |
| Henry's Law Constant | 3.0×10-3 mol/(m3Pa) at 25℃, Hine and Mookerjee (1975) |
| InChI | InChI=1S/C8H9Br/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 |
| InChIKey | HVRUGFJYCAFAAN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC=C1CC |
| CAS DataBase Reference | 1973-22-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2-ethyl-(1973-22-4) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335-H227 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P280a-P405-P501a | |||||||||
| Hazard Codes | Xi,N,O | |||||||||
| Risk Statements | 36/37/38-51/53 | |||||||||
| Safety Statements | 26-61-24/25 | |||||||||
| RIDADR | UN 3082 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 9 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29036990 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|
