N-(4-Methoxybenzylidene)aniline
- Product NameN-(4-Methoxybenzylidene)aniline
- CAS836-41-9
- MFC14H13NO
- MW211.26
- EINECS212-647-8
- MOL File836-41-9.mol
Chemical Properties
| Melting point | 63-67 °C |
| Boiling point | 339.0±25.0 °C(Predicted) |
| Density | 0.99±0.1 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 3.87±0.30(Predicted) |
| color | White to Light red to Green |
| BRN | 642337 |
| InChI | 1S/C14H13NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-11H,1H3/b15-11+ |
| InChIKey | MSWPGMRTURVKRJ-RVDMUPIBSA-N |
| SMILES | COc1ccc(cc1)\C=N\c2ccccc2 |
| CAS DataBase Reference | 836-41-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 36/37/38-51/53-22 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 2925.29.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
