Chemical Properties
| Melting point | 21.1°C |
| Boiling point | 410.55°C (rough estimate) |
| Density | 1.027 g/mL at 25 °C (lit.) |
| refractive index | 1.5486-1.5506 |
| Flash point | 113 °C |
| storage temp. | Refrigerator |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 4.24±0.50(Predicted) |
| color | White or Colorless to Light orange to Yellow |
| InChI | InChI=1S/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3 |
| InChIKey | FEIWNULTQYHCDN-UHFFFAOYSA-N |
| SMILES | C1(N=CC2=CC=C(OC)C=C2)=CC=C(CCCC)C=C1 |
| CAS DataBase Reference | 26227-73-6(CAS DataBase Reference) |
| EPA Substance Registry System | N-(4-Methoxybenzylidine)-4'-butylaniline (26227-73-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| RTECS | BW9550000 |
| HS Code | 2921.42.9000 |
