(-)-Epigallocatechin
- Product Name(-)-Epigallocatechin
- CAS970-74-1
- MFC15H14O7
- MW306.27
- EINECS619-254-4
- MOL File970-74-1.mol
Chemical Properties
| Melting point | 208-210°C |
| alpha | -50 º (c=0.04, EtOH) |
| Boiling point | 685.6±55.0 °C(Predicted) |
| Density | 1.695±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.02±0.15(Predicted) |
| color | White to Light Beige |
| biological source | green tea |
| λmax | 278nm(MeOH)(lit.) |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N |
| SMILES | O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c3cc(O)c(O)c(O)c3 |
| LogP | -0.100 (est) |
| CAS DataBase Reference | 970-74-1(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | KB5100000 |
| F | 3-10 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
