3-(Trifluoromethoxy)aniline
- Product Name3-(Trifluoromethoxy)aniline
- CAS1535-73-5
- MFC7H6F3NO
- MW177.12
- EINECS216-256-3
- MOL File1535-73-5.mol
Chemical Properties
| Boiling point | 72-73 °C8 mm Hg(lit.) |
| Density | 1.325 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 185 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 3.36±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.325 |
| color | Clear yellow to orange |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 776921 |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4H,11H2 |
| InChIKey | SADHVOSOZBAAGL-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 1535-73-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-27-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29222900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
