| Melting point |
20-22°C |
| Boiling point |
253 °C(lit.) |
| Density |
1.572 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.589(lit.) |
| Flash point |
135 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Almost white or Almost colorless |
| Sensitive |
Moisture Sensitive |
| BRN |
1956417 |
| InChI |
1S/C6H3Cl3O2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H |
| InChIKey |
NYIBPWGZGSXURD-UHFFFAOYSA-N |
| SMILES |
Clc1ccc(cc1Cl)S(Cl)(=O)=O |
| CAS DataBase Reference |
98-31-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonyl chloride, 3,4-dichloro- (98-31-7) |
