Tioxolone
- Product NameTioxolone
- CAS4991-65-5
- MFC7H4O3S
- MW168.17
- EINECS225-653-0
- MOL File4991-65-5.mol
Chemical Properties
| Melting point | 158-160 °C(lit.) |
| Boiling point | 267.1°C (rough estimate) |
| Density | 1.4844 (rough estimate) |
| refractive index | 1.5151 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to yellow |
| form | A solid |
| pka | 8.14±0.20(Predicted) |
| color | Light yellow to yellow |
| Water Solubility | 95% ethanol: soluble 50mg/mL, clear to very slightly hazy, colorless to yellow benzene: soluble diethyl ether: soluble isopropanol: soluble propylene glycol: soluble toluene: soluble water: insoluble |
| Merck | 9456 |
| Cosmetics Ingredients Functions | ASTRINGENT |
| InChI | InChI=1S/C7H4O3S/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3,8H |
| InChIKey | SLYPOVJCSQHITR-UHFFFAOYSA-N |
| SMILES | O1C2=CC(O)=CC=C2SC1=O |
| LogP | 1.770 (est) |
| CAS DataBase Reference | 4991-65-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Tioxolone(4991-65-5) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | DM2953750 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
