4-Chloro-3-methylphenol-2,6-d2
- Product Name4-Chloro-3-methylphenol-2,6-d2
- CAS93951-72-5
- MFC7H7ClO
- MW142.58
- EINECS
- MOL File93951-72-5.mol
Chemical Properties
| Melting point | 63-65 °C(lit.) |
| Boiling point | 235 °C(lit.) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3/i2D,4D |
| InChIKey | CFKMVGJGLGKFKI-XRIVEGAOSA-N |
| SMILES | [2H]c1cc(Cl)c(C)c([2H])c1O |
| EPA Substance Registry System | 4-Chloro-3-methylphenol-d2 (93951-72-5) |
| CAS Number Unlabeled | 59-50-7 |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 21/22-41-43-50 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN 3437 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | GO7100000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1B STOT SE 3 |