5'-Chloro-2'-hydroxy-4'-methylacetophenone
- Product Name5'-Chloro-2'-hydroxy-4'-methylacetophenone
- CAS28480-70-8
- MFC9H9ClO2
- MW184.62
- EINECS
- MOL File28480-70-8.mol
Chemical Properties
| Melting point | 70-73 °C(lit.) |
| Boiling point | 137 °C / 15mmHg |
| Density | 1.250±0.06 g/cm3(Predicted) |
| storage temp. | RT, stored under nitrogen |
| pka | 9.84±0.23(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C9H9ClO2/c1-5-3-9(12)7(6(2)11)4-8(5)10/h3-4,12H,1-2H3 |
| InChIKey | HDUSGGZSLVCDKY-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=C(C)C=C1O)C |
| CAS DataBase Reference | 28480-70-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2914.50.3000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
