TYRPHOSTIN A9
- Product NameTYRPHOSTIN A9
- CAS10537-47-0
- MFC18H22N2O
- MW282.38
- EINECS
- MOL File10537-47-0.mol
Chemical Properties
| Melting point | 141-143℃ (ethanol ) |
| Boiling point | 424.99°C (rough estimate) |
| Density | 1.0741 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethanol: 20 mg/mL |
| form | solid |
| pka | 7.55±0.40(Predicted) |
| color | yellow |
| biological source | synthetic (organic) |
| Stability | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| InChI | 1S/C18H22N2O/c1-17(2,3)14-8-12(7-13(10-19)11-20)9-15(16(14)21)18(4,5)6/h7-9,21H,1-6H3 |
| InChIKey | MZOPWQKISXCCTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(\C=C(\C#N)C#N)cc(c1O)C(C)(C)C |
| CAS DataBase Reference | 10537-47-0(CAS DataBase Reference) |
| EPA Substance Registry System | Malonoben (10537-47-0) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | OO3737000 |
| HS Code | 2926.90.5050 |
| HazardClass | 6.1 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral |
