N-(2-Hydroxyethyl)ethylenediamine-N,N',N'-triacetic acid trisodium salt
- Product NameN-(2-Hydroxyethyl)ethylenediamine-N,N',N'-triacetic acid trisodium salt
- CAS139-89-9
- MFC10H15N2Na3O7
- MW344.2
- EINECS205-381-9
- MOL File139-89-9.mol
Chemical Properties
| Melting point | 288 °C (dec.)(lit.) |
| Density | 1.285 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Store at RT. |
| solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 480g/L at 20℃ |
| Merck | 14,9966 |
| Stability | Hygroscopic |
| Cosmetics Ingredients Functions | CHELATING |
| InChI | InChI=1S/C10H18N2O7.3Na/c13-4-3-11(5-8(14)15)1-2-12(6-9(16)17)7-10(18)19;;;/h13H,1-7H2,(H,14,15)(H,16,17)(H,18,19);;;/q;3*+1/p-3 |
| InChIKey | WHNXAQZPEBNFBC-UHFFFAOYSA-K |
| SMILES | N(CC([O-])=O)(CC([O-])=O)CCN(CCO)CC([O-])=O.[Na+].[Na+].[Na+] |
| LogP | -11.35 |
| CAS DataBase Reference | 139-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | Trisodium (2-hydroxyethyl)ethylenediaminetriacetate (139-89-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | 9188000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 2922.50.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| Hazardous Substances Data | 139-89-9(Hazardous Substances Data) |