3,5-Diacetoxyacetophenone
- Product Name3,5-Diacetoxyacetophenone
- CAS35086-59-0
- MFC12H12O5
- MW236.22
- EINECS252-354-2
- MOL File35086-59-0.mol
Chemical Properties
| Melting point | 91-94 °C(lit.) |
| Boiling point | 165-168 °C (0.7501 mmHg) |
| Density | 1.3026 (rough estimate) |
| refractive index | 1.5140 (estimate) |
| Flash point | 168.7oC |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dichloromethane, Methanol |
| form | powder to crystal |
| color | White to Brown |
| Stability | Stable under normal temperatures and pressures. |
| InChI | InChI=1S/C12H12O5/c1-7(13)10-4-11(16-8(2)14)6-12(5-10)17-9(3)15/h4-6H,1-3H3 |
| InChIKey | QODJHYBESCIPOG-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(OC(C)=O)=CC(OC(C)=O)=C1)C |
| LogP | 1.5 at 25.5℃ |
| CAS DataBase Reference | 35086-59-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 9-21 |
| Hazard Note | Irritant |
| HS Code | 29145090 |
