Tris(2-thienyl)phosphine
- Product NameTris(2-thienyl)phosphine
- CAS24171-89-9
- MFC12H9PS3
- MW280.37
- EINECS246-059-8
- MOL File24171-89-9.mol
Chemical Properties
| Melting point | 29-30 °C |
| Boiling point | 205 °C / 2mmHg |
| Flash point | 25 °C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | solid |
| color | White or Colorless to Orange to Green |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 203736 |
| InChI | InChI=1S/C12H9PS3/c1-4-10(14-7-1)13(11-5-2-8-15-11)12-6-3-9-16-12/h1-9H |
| InChIKey | KUCPTMZJPDVWJL-UHFFFAOYSA-N |
| SMILES | P(C1SC=CC=1)(C1SC=CC=1)C1SC=CC=1 |
| CAS DataBase Reference | 24171-89-9(CAS DataBase Reference) |
