4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole
- Product Name4,7-Bis(2-bromo-5-thienyl)-2,1,3-benzothiadiazole
- CAS288071-87-4
- MFC14H6Br2N2S3
- MW458.21
- EINECS
- MOL File288071-87-4.mol
Chemical Properties
| Melting point | 245.0 to 249.0 °C |
| Boiling point | 527.3±45.0 °C(Predicted) |
| Density | 1.898 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| pka | -1.63±0.50(Predicted) |
| color | Orange to Brown to Dark purple |
| InChI | InChI=1S/C14H6Br2N2S3/c15-11-5-3-9(19-11)7-1-2-8(10-4-6-12(16)20-10)14-13(7)17-21-18-14/h1-6H |
| InChIKey | ZIIMIGRZSUYQGW-UHFFFAOYSA-N |
| SMILES | N1=C2C(C3SC(Br)=CC=3)=CC=C(C3SC(Br)=CC=3)C2=NS1 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
