treosulfan
- Product Nametreosulfan
- CAS299-75-2
- MFC6H14O8S2
- MW278.3
- EINECS206-081-0
- MOL File299-75-2.mol
Chemical Properties
| Melting point | 76-78 °C |
| Boiling point | 359.3°C (rough estimate) |
| Density | 1.305 (estimate) |
| refractive index | 1.5630 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 12.36±0.20(Predicted) |
| color | Off-White to Pale Beige |
| optical activity | [α]/D -4.9 to -5.9°, c =1 in acetone |
| Water Solubility | H2O: 5mg/mL, clear |
| InChI | InChI=1S/C6H14O8S2/c1-15(9,10)13-3-5(7)6(8)4-14-16(2,11)12/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | YCPOZVAOBBQLRI-WDSKDSINSA-N |
| SMILES | C(OS(C)(=O)=O)[C@H](O)[C@@H](O)COS(C)(=O)=O |
| CAS DataBase Reference | 299-75-2 |
| IARC | 1 (Vol. 26, Sup 7, 100A) 2012 |
| EPA Substance Registry System | Treosulfan (299-75-2) |
Safety Information
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1A Muta. 1B Repr. 2 |
| Hazardous Substances Data | 299-75-2(Hazardous Substances Data) |
| Toxicity | LDLo intravenous in dog: 222mg/kg |
